About nitro 2-aminoacetate;ruthenium
nitro 2-aminoacetate;ruthenium (PubChem CID 175369443) has the molecular formula C2H4N2O4Ru
and a molecular weight of 221.13 g/mol. Its IUPAC name is nitro 2-aminoacetate;ruthenium.
Molecular Properties
| Compound Name | nitro 2-aminoacetate;ruthenium |
| PubChem CID | 175369443 |
| Molecular Formula | C2H4N2O4Ru |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 221.92 |
| IUPAC Name | nitro 2-aminoacetate;ruthenium |
| SMILES | NCC(=O)O[N+](=O)[O-].[Ru] |
| InChI | InChI=1S/C2H4N2O4.Ru/c3-1-2(5)8-4(6)7;/h1,3H2; |
| InChIKey | LWNTVSVTIBUYHS-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitro 2-aminoacetate;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitro 2-aminoacetate;ruthenium?
The IUPAC name of nitro 2-aminoacetate;ruthenium (CID 175369443) is nitro 2-aminoacetate;ruthenium.
What is the SMILES notation for nitro 2-aminoacetate;ruthenium?
The canonical SMILES for nitro 2-aminoacetate;ruthenium is NCC(=O)O[N+](=O)[O-].[Ru].
What is the InChIKey of nitro 2-aminoacetate;ruthenium?
The InChIKey is LWNTVSVTIBUYHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N2O4.Ru/c3-1-2(5)8-4(6)7;/h1,3H2;.
What are the key properties of nitro 2-aminoacetate;ruthenium?
nitro 2-aminoacetate;ruthenium has a molecular weight of 221.13 g/mol, XLogP of -1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for nitro 2-aminoacetate;ruthenium is sourced from PubChem (CID 175369443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).