About bis(nitric acid);platinum
bis(nitric acid);platinum (PubChem CID 50910635) has the molecular formula H2N2O6Pt
and a molecular weight of 321.10 g/mol. Its IUPAC name is bis(nitric acid);platinum.
Molecular Properties
| Compound Name | bis(nitric acid);platinum |
| PubChem CID | 50910635 |
| Molecular Formula | H2N2O6Pt |
| Molecular Weight | 321.10 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | bis(nitric acid);platinum |
| SMILES | O=[N+]([O-])O.O=[N+]([O-])O.[Pt] |
| InChI | InChI=1S/2HNO3.Pt/c2*2-1(3)4;/h2*(H,2,3,4); |
| InChIKey | AJYKVULCFNACLO-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.10 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(nitric acid);platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(nitric acid);platinum?
The IUPAC name of bis(nitric acid);platinum (CID 50910635) is bis(nitric acid);platinum.
What is the SMILES notation for bis(nitric acid);platinum?
The canonical SMILES for bis(nitric acid);platinum is O=[N+]([O-])O.O=[N+]([O-])O.[Pt].
What is the InChIKey of bis(nitric acid);platinum?
The InChIKey is AJYKVULCFNACLO-UHFFFAOYSA-N. The full InChI is InChI=1S/2HNO3.Pt/c2*2-1(3)4;/h2*(H,2,3,4);.
What are the key properties of bis(nitric acid);platinum?
bis(nitric acid);platinum has a molecular weight of 321.10 g/mol, XLogP of -0.70, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(nitric acid);platinum is sourced from PubChem (CID 50910635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).