C4H10O9P2 — CID 44582844
(6S,7R)-2,4-dihydroxy-6-(hydroxymethyl)-2,4-dioxo-1,3,5,2λ5,4λ5-trioxadiphosphocan-7-ol (PubChem CID 44582844) has the molecular formula C4H10O9P2 and a molecular weight of 264.06 g/mol. Its IUPAC name is (6S,7R)-2,4-dihydroxy-6-(hydroxymethyl)-2,4-dioxo-1,3,5,2λ5,4λ5-trioxadiphosphocan-7-ol.
| Compound Name | (6S,7R)-2,4-dihydroxy-6-(hydroxymethyl)-2,4-dioxo-1,3,5,2λ5,4λ5-trioxadiphosphocan-7-ol |
|---|---|
| PubChem CID | 44582844 |
| Molecular Formula | C4H10O9P2 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | (6S,7R)-2,4-dihydroxy-6-(hydroxymethyl)-2,4-dioxo-1,3,5,2λ5,4λ5-trioxadiphosphocan-7-ol |
| SMILES | O=P1(O)OC[C@@H](O)[C@H](CO)OP(=O)(O)O1 |
| InChI | InChI=1S/C4H10O9P2/c5-1-4-3(6)2-11-14(7,8)13-15(9,10)12-4/h3-6H,1-2H2,(H,7,8)(H,9,10)/t3-,4+/m1/s1 |
| InChIKey | YFHHHCXTKBYOFV-DMTCNVIQSA-N |
| XLogP | -1.03 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|