C4H9O6P — CID 10535473
(3S,4S,5R)-2-hydroxy-2-oxo-1,2lambda5-oxaphosphinane-3,4,5-triol (PubChem CID 10535473) has the molecular formula C4H9O6P and a molecular weight of 184.08 g/mol. Its IUPAC name is (3S,4S,5R)-2-hydroxy-2-oxo-1,2lambda5-oxaphosphinane-3,4,5-triol.
| Compound Name | (3S,4S,5R)-2-hydroxy-2-oxo-1,2lambda5-oxaphosphinane-3,4,5-triol |
|---|---|
| PubChem CID | 10535473 |
| Molecular Formula | C4H9O6P |
| Molecular Weight | 184.08 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | (3S,4S,5R)-2-hydroxy-2-oxo-1,2lambda5-oxaphosphinane-3,4,5-triol |
| SMILES | O=P1(O)OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C4H9O6P/c5-2-1-10-11(8,9)4(7)3(2)6/h2-7H,1H2,(H,8,9)/t2-,3+,4+/m1/s1 |
| InChIKey | AXPATDXAJKIVLI-UZBSEBFBSA-N |
| XLogP | -1.76 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.08 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|