C13H24O16P2 — CID 143685478
(5R)-3,12-dihydroxy-3,12-dioxo-2,4,11,13-tetraoxa-3λ5,12λ5-diphosphatricyclo[12.5.0.05,10]nonadecane-6,7,8,9,15,16,17,19-octol (PubChem CID 143685478) has the molecular formula C13H24O16P2 and a molecular weight of 498.27 g/mol. Its IUPAC name is (5R)-3,12-dihydroxy-3,12-dioxo-2,4,11,13-tetraoxa-3λ5,12λ5-diphosphatricyclo[12.5.0.05,10]nonadecane-6,7,8,9,15,16,17,19-octol.
| Compound Name | (5R)-3,12-dihydroxy-3,12-dioxo-2,4,11,13-tetraoxa-3λ5,12λ5-diphosphatricyclo[12.5.0.05,10]nonadecane-6,7,8,9,15,16,17,19-octol |
|---|---|
| PubChem CID | 143685478 |
| Molecular Formula | C13H24O16P2 |
| Molecular Weight | 498.27 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | (5R)-3,12-dihydroxy-3,12-dioxo-2,4,11,13-tetraoxa-3λ5,12λ5-diphosphatricyclo[12.5.0.05,10]nonadecane-6,7,8,9,15,16,17,19-octol |
| SMILES | O=P1(O)OC2C(O)C(O)C(O)CC(O)C2OP(=O)(O)O[C@@H]2C(O)C(O)C(O)C(O)C2O1 |
| InChI | InChI=1S/C13H24O16P2/c14-2-1-3(15)10-11(7(19)4(2)16)27-31(24,25)29-13-9(21)6(18)5(17)8(20)12(13)28-30(22,23)26-10/h2-21H,1H2,(H,22,23)(H,24,25)/t2?,3?,4?,5?,6?,7?,8?,9?,10?,11?,12-,13?/m1/s1 |
| InChIKey | MMWGENSVXVIDDU-KGZOKLRASA-N |
| XLogP | -4.95 |
| TPSA | 273.36 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.27 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|