C5H12NO3P — CID 101188020
(3S,5S)-2-hydroxy-3-methyl-2-oxo-1,2λ5-oxaphosphinan-5-amine (PubChem CID 101188020) has the molecular formula C5H12NO3P and a molecular weight of 165.13 g/mol. Its IUPAC name is (3S,5S)-2-hydroxy-3-methyl-2-oxo-1,2λ5-oxaphosphinan-5-amine.
| Compound Name | (3S,5S)-2-hydroxy-3-methyl-2-oxo-1,2λ5-oxaphosphinan-5-amine |
|---|---|
| PubChem CID | 101188020 |
| Molecular Formula | C5H12NO3P |
| Molecular Weight | 165.13 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (3S,5S)-2-hydroxy-3-methyl-2-oxo-1,2λ5-oxaphosphinan-5-amine |
| SMILES | C[C@H]1C[C@H](N)COP1(=O)O |
| InChI | InChI=1S/C5H12NO3P/c1-4-2-5(6)3-9-10(4,7)8/h4-5H,2-3,6H2,1H3,(H,7,8)/t4-,5-/m0/s1 |
| InChIKey | SLPZUKGKUOUSBS-WHFBIAKZSA-N |
| XLogP | 0.31 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|