C7H14O20P6 — CID 118227607
4,6,11,13,18,20-hexahydroxy-20-methylidene-3,5,7,10,12,14,17,19,21-nonaoxa-4λ5,6λ5,11λ5,13λ5,18λ5,20λ5-hexaphosphatetracyclo[14.5.0.02,8.09,15]henicosane 4,6,11,13,18-pentaoxide (PubChem CID 118227607) has the molecular formula C7H14O20P6 and a molecular weight of 604.01 g/mol. Its IUPAC name is 4,6,11,13,18,20-hexahydroxy-20-methylidene-3,5,7,10,12,14,17,19,21-nonaoxa-4λ5,6λ5,11λ5,13λ5,18λ5,20λ5-hexaphosphatetracyclo[14.5.0.02,8.09,15]henicosane 4,6,11,13,18-pentaoxide.
| Compound Name | 4,6,11,13,18,20-hexahydroxy-20-methylidene-3,5,7,10,12,14,17,19,21-nonaoxa-4λ5,6λ5,11λ5,13λ5,18λ5,20λ5-hexaphosphatetracyclo[14.5.0.02,8.09,15]henicosane 4,6,11,13,18-pentaoxide |
|---|---|
| PubChem CID | 118227607 |
| Molecular Formula | C7H14O20P6 |
| Molecular Weight | 604.01 g/mol |
| Exact Mass | 603.85 |
| IUPAC Name | 4,6,11,13,18,20-hexahydroxy-20-methylidene-3,5,7,10,12,14,17,19,21-nonaoxa-4λ5,6λ5,11λ5,13λ5,18λ5,20λ5-hexaphosphatetracyclo[14.5.0.02,8.09,15]henicosane 4,6,11,13,18-pentaoxide |
| SMILES | C=P1(O)OC2C(OP(=O)(O)O1)C1OP(=O)(O)OP(=O)(O)OC1C1OP(=O)(O)OP(=O)(O)OC21 |
| InChI | InChI=1S/C7H14O20P6/c1-28(8)19-2-3(20-29(9,10)25-28)5-7(24-33(17,18)27-31(13,14)22-5)6-4(2)21-30(11,12)26-32(15,16)23-6/h2-8H,1H2,(H,9,10)(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | LVSHOFQKVFQBJQ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 289.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.01 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|