C20H43N — CID 141372550
N,N-dibutyl-5-propylnonan-5-amine (PubChem CID 141372550) has the molecular formula C20H43N and a molecular weight of 297.57 g/mol. Its IUPAC name is N,N-dibutyl-5-propylnonan-5-amine.
| Compound Name | N,N-dibutyl-5-propylnonan-5-amine |
|---|---|
| PubChem CID | 141372550 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | N,N-dibutyl-5-propylnonan-5-amine |
| SMILES | CCCCN(CCCC)C(CCC)(CCCC)CCCC |
| InChI | InChI=1S/C20H43N/c1-6-11-16-20(15-10-5,17-12-7-2)21(18-13-8-3)19-14-9-4/h6-19H2,1-5H3 |
| InChIKey | OOKBPYDFXKADJK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |