C15H34N2 — CID 79062661
4-N,3-diethyl-3-N,3-N,7-trimethyloctane-3,4-diamine (PubChem CID 79062661) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 4-N,3-diethyl-3-N,3-N,7-trimethyloctane-3,4-diamine.
| Compound Name | 4-N,3-diethyl-3-N,3-N,7-trimethyloctane-3,4-diamine |
|---|---|
| PubChem CID | 79062661 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | 4-N,3-diethyl-3-N,3-N,7-trimethyloctane-3,4-diamine |
| SMILES | CCNC(CCC(C)C)C(CC)(CC)N(C)C |
| InChI | InChI=1S/C15H34N2/c1-8-15(9-2,17(6)7)14(16-10-3)12-11-13(4)5/h13-14,16H,8-12H2,1-7H3 |
| InChIKey | SNYXJBDKNDCHRR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |