C15H35N3 — CID 105241689
3-ethyl-4-hydrazinyl-N,N-dimethylundecan-3-amine (PubChem CID 105241689) has the molecular formula C15H35N3 and a molecular weight of 257.47 g/mol. Its IUPAC name is 3-ethyl-4-hydrazinyl-N,N-dimethylundecan-3-amine.
| Compound Name | 3-ethyl-4-hydrazinyl-N,N-dimethylundecan-3-amine |
|---|---|
| PubChem CID | 105241689 |
| Molecular Formula | C15H35N3 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.28 |
| IUPAC Name | 3-ethyl-4-hydrazinyl-N,N-dimethylundecan-3-amine |
| SMILES | CCCCCCCC(NN)C(CC)(CC)N(C)C |
| InChI | InChI=1S/C15H35N3/c1-6-9-10-11-12-13-14(17-16)15(7-2,8-3)18(4)5/h14,17H,6-13,16H2,1-5H3 |
| InChIKey | BTZIUBYSPNWCOO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|