C24H43NO2 — CID 141363244
N,N-bis(2-ethylhexyl)-3-(2H-pyran-3-yl)propanamide (PubChem CID 141363244) has the molecular formula C24H43NO2 and a molecular weight of 377.61 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-3-(2H-pyran-3-yl)propanamide.
| Compound Name | N,N-bis(2-ethylhexyl)-3-(2H-pyran-3-yl)propanamide |
|---|---|
| PubChem CID | 141363244 |
| Molecular Formula | C24H43NO2 |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-3-(2H-pyran-3-yl)propanamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)CCC1=CC=COC1 |
| InChI | InChI=1S/C24H43NO2/c1-5-9-12-21(7-3)18-25(19-22(8-4)13-10-6-2)24(26)16-15-23-14-11-17-27-20-23/h11,14,17,21-22H,5-10,12-13,15-16,18-20H2,1-4H3 |
| InChIKey | VBNIXCVUXSFQHF-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |