C26H44N2O3 — CID 177435177
2-[[2-[bis(2-ethylhexyl)amino]-2-oxoethyl]amino]-2-phenylacetic acid (PubChem CID 177435177) has the molecular formula C26H44N2O3 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2-[[2-[bis(2-ethylhexyl)amino]-2-oxoethyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[2-[bis(2-ethylhexyl)amino]-2-oxoethyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 177435177 |
| Molecular Formula | C26H44N2O3 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | 2-[[2-[bis(2-ethylhexyl)amino]-2-oxoethyl]amino]-2-phenylacetic acid |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)CNC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H44N2O3/c1-5-9-14-21(7-3)19-28(20-22(8-4)15-10-6-2)24(29)18-27-25(26(30)31)23-16-12-11-13-17-23/h11-13,16-17,21-22,25,27H,5-10,14-15,18-20H2,1-4H3,(H,30,31) |
| InChIKey | DAIVTTQMUSVOEW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |