C10H31N3O6P2 — CID 138397294
azane;[2-ethylhexyl(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 138397294) has the molecular formula C10H31N3O6P2 and a molecular weight of 351.32 g/mol. Its IUPAC name is azane;[2-ethylhexyl(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | azane;[2-ethylhexyl(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 138397294 |
| Molecular Formula | C10H31N3O6P2 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | azane;[2-ethylhexyl(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | CCCCC(CC)CN(CP(=O)(O)O)CP(=O)(O)O.N.N |
| InChI | InChI=1S/C10H25NO6P2.2H3N/c1-3-5-6-10(4-2)7-11(8-18(12,13)14)9-19(15,16)17;;/h10H,3-9H2,1-2H3,(H2,12,13,14)(H2,15,16,17);2*1H3 |
| InChIKey | QHRUBDXIOFVCOS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 188.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|