C13H26N2 — CID 114415974
2-N-but-3-yn-2-ylnonane-1,2-diamine (PubChem CID 114415974) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 2-N-but-3-yn-2-ylnonane-1,2-diamine.
| Compound Name | 2-N-but-3-yn-2-ylnonane-1,2-diamine |
|---|---|
| PubChem CID | 114415974 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2-N-but-3-yn-2-ylnonane-1,2-diamine |
| SMILES | C#CC(C)NC(CN)CCCCCCC |
| InChI | InChI=1S/C13H26N2/c1-4-6-7-8-9-10-13(11-14)15-12(3)5-2/h2,12-13,15H,4,6-11,14H2,1,3H3 |
| InChIKey | ORVAPBIHTKFJFR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|