C13H30N2 — CID 65385407
2-N-(2-methylpropyl)nonane-1,2-diamine (PubChem CID 65385407) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2-N-(2-methylpropyl)nonane-1,2-diamine.
| Compound Name | 2-N-(2-methylpropyl)nonane-1,2-diamine |
|---|---|
| PubChem CID | 65385407 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 2-N-(2-methylpropyl)nonane-1,2-diamine |
| SMILES | CCCCCCCC(CN)NCC(C)C |
| InChI | InChI=1S/C13H30N2/c1-4-5-6-7-8-9-13(10-14)15-11-12(2)3/h12-13,15H,4-11,14H2,1-3H3 |
| InChIKey | RFBPZUCMSNYFFE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|