C13H28F2N2 — CID 114078509
2-N-(2,2-difluoroethyl)undecane-1,2-diamine (PubChem CID 114078509) has the molecular formula C13H28F2N2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-N-(2,2-difluoroethyl)undecane-1,2-diamine.
| Compound Name | 2-N-(2,2-difluoroethyl)undecane-1,2-diamine |
|---|---|
| PubChem CID | 114078509 |
| Molecular Formula | C13H28F2N2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 2-N-(2,2-difluoroethyl)undecane-1,2-diamine |
| SMILES | CCCCCCCCCC(CN)NCC(F)F |
| InChI | InChI=1S/C13H28F2N2/c1-2-3-4-5-6-7-8-9-12(10-16)17-11-13(14)15/h12-13,17H,2-11,16H2,1H3 |
| InChIKey | USMPHJNKDXVLOJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|