C15H25FN2 — CID 65378747
2-N-(4-fluorophenyl)nonane-1,2-diamine (PubChem CID 65378747) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)nonane-1,2-diamine.
| Compound Name | 2-N-(4-fluorophenyl)nonane-1,2-diamine |
|---|---|
| PubChem CID | 65378747 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 2-N-(4-fluorophenyl)nonane-1,2-diamine |
| SMILES | CCCCCCCC(CN)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C15H25FN2/c1-2-3-4-5-6-7-15(12-17)18-14-10-8-13(16)9-11-14/h8-11,15,18H,2-7,12,17H2,1H3 |
| InChIKey | GZURCHWTKAYUPB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|