C8H18F2N2S — CID 116504214
2-N-(2,2-difluoroethyl)-4-ethylsulfanylbutane-1,2-diamine (PubChem CID 116504214) has the molecular formula C8H18F2N2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 2-N-(2,2-difluoroethyl)-4-ethylsulfanylbutane-1,2-diamine.
| Compound Name | 2-N-(2,2-difluoroethyl)-4-ethylsulfanylbutane-1,2-diamine |
|---|---|
| PubChem CID | 116504214 |
| Molecular Formula | C8H18F2N2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-N-(2,2-difluoroethyl)-4-ethylsulfanylbutane-1,2-diamine |
| SMILES | CCSCCC(CN)NCC(F)F |
| InChI | InChI=1S/C8H18F2N2S/c1-2-13-4-3-7(5-11)12-6-8(9)10/h7-8,12H,2-6,11H2,1H3 |
| InChIKey | RPZVSKBDIVZXQG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|