C6H16N2S — CID 116503979
4-ethylsulfanylbutane-1,2-diamine (PubChem CID 116503979) has the molecular formula C6H16N2S and a molecular weight of 148.27 g/mol. Its IUPAC name is 4-ethylsulfanylbutane-1,2-diamine.
| Compound Name | 4-ethylsulfanylbutane-1,2-diamine |
|---|---|
| PubChem CID | 116503979 |
| Molecular Formula | C6H16N2S |
| Molecular Weight | 148.27 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4-ethylsulfanylbutane-1,2-diamine |
| SMILES | CCSCCC(N)CN |
| InChI | InChI=1S/C6H16N2S/c1-2-9-4-3-6(8)5-7/h6H,2-5,7-8H2,1H3 |
| InChIKey | AWTZBNYRTCEXMS-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|