C12H28N2S — CID 116503968
4-ethylsulfanyl-2-N-propan-2-yl-2-N-propylbutane-1,2-diamine (PubChem CID 116503968) has the molecular formula C12H28N2S and a molecular weight of 232.44 g/mol. Its IUPAC name is 4-ethylsulfanyl-2-N-propan-2-yl-2-N-propylbutane-1,2-diamine.
| Compound Name | 4-ethylsulfanyl-2-N-propan-2-yl-2-N-propylbutane-1,2-diamine |
|---|---|
| PubChem CID | 116503968 |
| Molecular Formula | C12H28N2S |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 4-ethylsulfanyl-2-N-propan-2-yl-2-N-propylbutane-1,2-diamine |
| SMILES | CCCN(C(C)C)C(CN)CCSCC |
| InChI | InChI=1S/C12H28N2S/c1-5-8-14(11(3)4)12(10-13)7-9-15-6-2/h11-12H,5-10,13H2,1-4H3 |
| InChIKey | ZGHDDGFJRWWXOL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|