C13H31N3S — CID 102991983
2-N-[3-(dimethylamino)propyl]-2-N-ethyl-4-ethylsulfanylbutane-1,2-diamine (PubChem CID 102991983) has the molecular formula C13H31N3S and a molecular weight of 261.48 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-2-N-ethyl-4-ethylsulfanylbutane-1,2-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-2-N-ethyl-4-ethylsulfanylbutane-1,2-diamine |
|---|---|
| PubChem CID | 102991983 |
| Molecular Formula | C13H31N3S |
| Molecular Weight | 261.48 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-2-N-ethyl-4-ethylsulfanylbutane-1,2-diamine |
| SMILES | CCSCCC(CN)N(CC)CCCN(C)C |
| InChI | InChI=1S/C13H31N3S/c1-5-16(10-7-9-15(3)4)13(12-14)8-11-17-6-2/h13H,5-12,14H2,1-4H3 |
| InChIKey | PVSMXJBHLNPWGN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|