C11H27N3S — CID 116504125
2-N-[2-(dimethylamino)ethyl]-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine (PubChem CID 116504125) has the molecular formula C11H27N3S and a molecular weight of 233.42 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 116504125 |
| Molecular Formula | C11H27N3S |
| Molecular Weight | 233.42 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine |
| SMILES | CCSCCC(CN)N(C)CCN(C)C |
| InChI | InChI=1S/C11H27N3S/c1-5-15-9-6-11(10-12)14(4)8-7-13(2)3/h11H,5-10,12H2,1-4H3 |
| InChIKey | OGCCKMVJKPXISD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|