C14H31N3S — CID 116504059
2-N-(1-ethylpiperidin-4-yl)-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine (PubChem CID 116504059) has the molecular formula C14H31N3S and a molecular weight of 273.49 g/mol. Its IUPAC name is 2-N-(1-ethylpiperidin-4-yl)-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine.
| Compound Name | 2-N-(1-ethylpiperidin-4-yl)-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 116504059 |
| Molecular Formula | C14H31N3S |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 2-N-(1-ethylpiperidin-4-yl)-4-ethylsulfanyl-2-N-methylbutane-1,2-diamine |
| SMILES | CCSCCC(CN)N(C)C1CCN(CC)CC1 |
| InChI | InChI=1S/C14H31N3S/c1-4-17-9-6-13(7-10-17)16(3)14(12-15)8-11-18-5-2/h13-14H,4-12,15H2,1-3H3 |
| InChIKey | YHBCUOXKAXGZJV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|