C6H15NS2 — CID 100935069
N-methyl-1,3-bis(methylsulfanyl)propan-2-amine (PubChem CID 100935069) has the molecular formula C6H15NS2 and a molecular weight of 165.33 g/mol. Its IUPAC name is N-methyl-1,3-bis(methylsulfanyl)propan-2-amine.
| Compound Name | N-methyl-1,3-bis(methylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 100935069 |
| Molecular Formula | C6H15NS2 |
| Molecular Weight | 165.33 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | N-methyl-1,3-bis(methylsulfanyl)propan-2-amine |
| SMILES | CNC(CSC)CSC |
| InChI | InChI=1S/C6H15NS2/c1-7-6(4-8-2)5-9-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | DNPUATAKDSLDGI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |