C11H15ClFNS — CID 114855536
1-(4-chloro-2-fluorophenyl)-N-methyl-3-methylsulfanylpropan-2-amine (PubChem CID 114855536) has the molecular formula C11H15ClFNS and a molecular weight of 247.77 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-N-methyl-3-methylsulfanylpropan-2-amine.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-N-methyl-3-methylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 114855536 |
| Molecular Formula | C11H15ClFNS |
| Molecular Weight | 247.77 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-N-methyl-3-methylsulfanylpropan-2-amine |
| SMILES | CNC(CSC)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H15ClFNS/c1-14-10(7-15-2)5-8-3-4-9(12)6-11(8)13/h3-4,6,10,14H,5,7H2,1-2H3 |
| InChIKey | DSMPOUGBHVBZAF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |