C16H16Cl2FNO — CID 105190357
1-(4-chloro-2-fluorophenyl)-3-(3-chlorophenoxy)-N-methylpropan-2-amine (PubChem CID 105190357) has the molecular formula C16H16Cl2FNO and a molecular weight of 328.21 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-(3-chlorophenoxy)-N-methylpropan-2-amine.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-(3-chlorophenoxy)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 105190357 |
| Molecular Formula | C16H16Cl2FNO |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-(3-chlorophenoxy)-N-methylpropan-2-amine |
| SMILES | CNC(COc1cccc(Cl)c1)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C16H16Cl2FNO/c1-20-14(7-11-5-6-13(18)9-16(11)19)10-21-15-4-2-3-12(17)8-15/h2-6,8-9,14,20H,7,10H2,1H3 |
| InChIKey | KMYCFADCQSOTMT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |