C12H23NO4S — CID 170899691
(3R)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-methylsulfanylpentanoic acid (PubChem CID 170899691) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is (3R)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-methylsulfanylpentanoic acid.
| Compound Name | (3R)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-methylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 170899691 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (3R)-3-(methylamino)-2-[(2-methylpropan-2-yl)oxycarbonyl]-5-methylsulfanylpentanoic acid |
| SMILES | CN[C@H](CCSC)C(C(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO4S/c1-12(2,3)17-11(16)9(10(14)15)8(13-4)6-7-18-5/h8-9,13H,6-7H2,1-5H3,(H,14,15)/t8-,9?/m1/s1 |
| InChIKey | IISXSTZWBZCJPA-VEDVMXKPSA-N |
| XLogP | 1.37 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|