C14H23N — CID 63561742
N,2-dimethyl-1-(4-methylphenyl)pentan-3-amine (PubChem CID 63561742) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is N,2-dimethyl-1-(4-methylphenyl)pentan-3-amine.
| Compound Name | N,2-dimethyl-1-(4-methylphenyl)pentan-3-amine |
|---|---|
| PubChem CID | 63561742 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N,2-dimethyl-1-(4-methylphenyl)pentan-3-amine |
| SMILES | CCC(NC)C(C)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C14H23N/c1-5-14(15-4)12(3)10-13-8-6-11(2)7-9-13/h6-9,12,14-15H,5,10H2,1-4H3 |
| InChIKey | BAAPAONAKWTZFF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |