C14H22FN — CID 61065370
3-ethyl-1-(4-fluorophenyl)-N-methylpentan-2-amine (PubChem CID 61065370) has the molecular formula C14H22FN and a molecular weight of 223.34 g/mol. Its IUPAC name is 3-ethyl-1-(4-fluorophenyl)-N-methylpentan-2-amine.
| Compound Name | 3-ethyl-1-(4-fluorophenyl)-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 61065370 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 3-ethyl-1-(4-fluorophenyl)-N-methylpentan-2-amine |
| SMILES | CCC(CC)C(Cc1ccc(F)cc1)NC |
| InChI | InChI=1S/C14H22FN/c1-4-12(5-2)14(16-3)10-11-6-8-13(15)9-7-11/h6-9,12,14,16H,4-5,10H2,1-3H3 |
| InChIKey | FGNNORPIOHISPP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |