C11H27NS — CID 161290387
sulfane;(4S)-N,2,2,6-tetramethylheptan-4-amine (PubChem CID 161290387) has the molecular formula C11H27NS and a molecular weight of 205.41 g/mol. Its IUPAC name is sulfane;(4S)-N,2,2,6-tetramethylheptan-4-amine.
| Compound Name | sulfane;(4S)-N,2,2,6-tetramethylheptan-4-amine |
|---|---|
| PubChem CID | 161290387 |
| Molecular Formula | C11H27NS |
| Molecular Weight | 205.41 g/mol |
| Exact Mass | 205.19 |
| IUPAC Name | sulfane;(4S)-N,2,2,6-tetramethylheptan-4-amine |
| SMILES | CN[C@@H](CC(C)C)CC(C)(C)C.S |
| InChI | InChI=1S/C11H25N.H2S/c1-9(2)7-10(12-6)8-11(3,4)5;/h9-10,12H,7-8H2,1-6H3;1H2/t10-;/m0./s1 |
| InChIKey | VGGPQLKIPGCYKD-PPHPATTJSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |