About 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine
6-ethyl-2,2-dimethyl-N-propyloctan-4-amine (PubChem CID 82923150) has the molecular formula C15H33N
and a molecular weight of 227.44 g/mol. Its IUPAC name is 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine |
| PubChem CID | 82923150 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine |
| SMILES | CCCNC(CC(CC)CC)CC(C)(C)C |
| InChI | InChI=1S/C15H33N/c1-7-10-16-14(12-15(4,5)6)11-13(8-2)9-3/h13-14,16H,7-12H2,1-6H3 |
| InChIKey | FVNSREODQISEKF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine?
The IUPAC name of 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine (CID 82923150) is 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine.
What is the SMILES notation for 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine?
The canonical SMILES for 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine is CCCNC(CC(CC)CC)CC(C)(C)C.
What is the InChIKey of 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine?
The InChIKey is FVNSREODQISEKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N/c1-7-10-16-14(12-15(4,5)6)11-13(8-2)9-3/h13-14,16H,7-12H2,1-6H3.
What are the key properties of 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine?
6-ethyl-2,2-dimethyl-N-propyloctan-4-amine has a molecular weight of 227.44 g/mol, XLogP of 4.62, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,2-dimethyl-N-propyloctan-4-amine is sourced from PubChem (CID 82923150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).