C10H2F12O6S2 — CID 118520299
1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluorophenyl)sulfonylethoxy]ethanesulfonic acid (PubChem CID 118520299) has the molecular formula C10H2F12O6S2 and a molecular weight of 510.23 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluorophenyl)sulfonylethoxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluorophenyl)sulfonylethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 118520299 |
| Molecular Formula | C10H2F12O6S2 |
| Molecular Weight | 510.23 g/mol |
| Exact Mass | 509.91 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,3,5,6-tetrafluorophenyl)sulfonylethoxy]ethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)S(=O)(=O)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C10H2F12O6S2/c11-2-1-3(12)5(14)6(4(2)13)29(23,24)9(19,20)7(15,16)28-8(17,18)10(21,22)30(25,26)27/h1H,(H,25,26,27) |
| InChIKey | DFJPYVRLCIFCHQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|