C9H5F6O4S- — CID 59344337
1,1,2,2,3,3-hexafluoro-3-phenoxypropane-1-sulfonate (PubChem CID 59344337) has the molecular formula C9H5F6O4S- and a molecular weight of 323.19 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-phenoxypropane-1-sulfonate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-phenoxypropane-1-sulfonate |
|---|---|
| PubChem CID | 59344337 |
| Molecular Formula | C9H5F6O4S- |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-phenoxypropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/C9H6F6O4S/c10-7(11,9(14,15)20(16,17)18)8(12,13)19-6-4-2-1-3-5-6/h1-5H,(H,16,17,18)/p-1 |
| InChIKey | MBRBYECKQNPUTM-UHFFFAOYSA-M |
| XLogP | 2.43 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|