C8H5F5O3S — CID 154731388
1,1,2,2-tetrafluoro-2-phenoxyethanesulfonyl fluoride (PubChem CID 154731388) has the molecular formula C8H5F5O3S and a molecular weight of 276.18 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-phenoxyethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-phenoxyethanesulfonyl fluoride |
|---|---|
| PubChem CID | 154731388 |
| Molecular Formula | C8H5F5O3S |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-phenoxyethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/C8H5F5O3S/c9-7(10,8(11,12)17(13,14)15)16-6-4-2-1-3-5-6/h1-5H |
| InChIKey | ODVYSLQVDANVOV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|