fluoro(phenyl)methanedisulfonyl fluoride

C7H5F3O4S2 — CID 170192333

IUPACfluoro(phenyl)methanedisulfonyl fluoride
SMILESO=S(=O)(F)C(F)(c1ccccc1)S(=O)(=O)F
InChIInChI=1S/C7H5F3O4S2/c8-7(15(9,11)12,16(10,13)14)6-4-2-1-3-5-6/h1-5H
InChIKeyOOVGMEBXEIJNRZ-UHFFFAOYSA-N
MW274.24 g/mol
LogP1.37
Rot. Bonds3

About fluoro(phenyl)methanedisulfonyl fluoride

fluoro(phenyl)methanedisulfonyl fluoride (PubChem CID 170192333) has the molecular formula C7H5F3O4S2 and a molecular weight of 274.24 g/mol. Its IUPAC name is fluoro(phenyl)methanedisulfonyl fluoride.

Molecular Properties

Compound Namefluoro(phenyl)methanedisulfonyl fluoride
PubChem CID170192333
Molecular FormulaC7H5F3O4S2
Molecular Weight274.24 g/mol
Exact Mass273.96
IUPAC Namefluoro(phenyl)methanedisulfonyl fluoride
SMILESO=S(=O)(F)C(F)(c1ccccc1)S(=O)(=O)F
InChIInChI=1S/C7H5F3O4S2/c8-7(15(9,11)12,16(10,13)14)6-4-2-1-3-5-6/h1-5H
InChIKeyOOVGMEBXEIJNRZ-UHFFFAOYSA-N
XLogP1.37
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.24
LogP ≤ 51.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze fluoro(phenyl)methanedisulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoro(phenyl)methanedisulfonyl fluoride?
The IUPAC name of fluoro(phenyl)methanedisulfonyl fluoride (CID 170192333) is fluoro(phenyl)methanedisulfonyl fluoride.
What is the SMILES notation for fluoro(phenyl)methanedisulfonyl fluoride?
The canonical SMILES for fluoro(phenyl)methanedisulfonyl fluoride is O=S(=O)(F)C(F)(c1ccccc1)S(=O)(=O)F.
What is the InChIKey of fluoro(phenyl)methanedisulfonyl fluoride?
The InChIKey is OOVGMEBXEIJNRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3O4S2/c8-7(15(9,11)12,16(10,13)14)6-4-2-1-3-5-6/h1-5H.
What are the key properties of fluoro(phenyl)methanedisulfonyl fluoride?
fluoro(phenyl)methanedisulfonyl fluoride has a molecular weight of 274.24 g/mol, XLogP of 1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(phenyl)methanedisulfonyl fluoride is sourced from PubChem (CID 170192333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).