C13H7F6O4S- — CID 59344331
1,1,2,2,3,3-hexafluoro-3-naphthalen-2-yloxypropane-1-sulfonate (PubChem CID 59344331) has the molecular formula C13H7F6O4S- and a molecular weight of 373.25 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-naphthalen-2-yloxypropane-1-sulfonate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-naphthalen-2-yloxypropane-1-sulfonate |
|---|---|
| PubChem CID | 59344331 |
| Molecular Formula | C13H7F6O4S- |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-naphthalen-2-yloxypropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H8F6O4S/c14-11(15,13(18,19)24(20,21)22)12(16,17)23-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,20,21,22)/p-1 |
| InChIKey | KNELPVIEITVYSP-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|