C12H8F3NO4 — CID 62206357
5-[3-(trifluoromethoxy)anilino]furan-2-carboxylic acid (PubChem CID 62206357) has the molecular formula C12H8F3NO4 and a molecular weight of 287.19 g/mol. Its IUPAC name is 5-[3-(trifluoromethoxy)anilino]furan-2-carboxylic acid.
| Compound Name | 5-[3-(trifluoromethoxy)anilino]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62206357 |
| Molecular Formula | C12H8F3NO4 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-[3-(trifluoromethoxy)anilino]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Nc2cccc(OC(F)(F)F)c2)o1 |
| InChI | InChI=1S/C12H8F3NO4/c13-12(14,15)20-8-3-1-2-7(6-8)16-10-5-4-9(19-10)11(17)18/h1-6,16H,(H,17,18) |
| InChIKey | RXUCABADFBCJTQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |