C15H15Cl2F3N2O2 — CID 165436568
4-(aminomethyl)-N-[3-(trifluoromethoxy)phenyl]benzamide;dihydrochloride (PubChem CID 165436568) has the molecular formula C15H15Cl2F3N2O2 and a molecular weight of 383.20 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-(trifluoromethoxy)phenyl]benzamide;dihydrochloride.
| Compound Name | 4-(aminomethyl)-N-[3-(trifluoromethoxy)phenyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 165436568 |
| Molecular Formula | C15H15Cl2F3N2O2 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 4-(aminomethyl)-N-[3-(trifluoromethoxy)phenyl]benzamide;dihydrochloride |
| SMILES | Cl.Cl.NCc1ccc(C(=O)Nc2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H13F3N2O2.2ClH/c16-15(17,18)22-13-3-1-2-12(8-13)20-14(21)11-6-4-10(9-19)5-7-11;;/h1-8H,9,19H2,(H,20,21);2*1H |
| InChIKey | HNAAMRQGIRMJIL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |