C18H16F3NO2S2 — CID 38206907
4-(1,3-dithian-2-yl)-N-[3-(trifluoromethoxy)phenyl]benzamide (PubChem CID 38206907) has the molecular formula C18H16F3NO2S2 and a molecular weight of 399.46 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-N-[3-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-(1,3-dithian-2-yl)-N-[3-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 38206907 |
| Molecular Formula | C18H16F3NO2S2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-N-[3-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C18H16F3NO2S2/c19-18(20,21)24-15-4-1-3-14(11-15)22-16(23)12-5-7-13(8-6-12)17-25-9-2-10-26-17/h1,3-8,11,17H,2,9-10H2,(H,22,23) |
| InChIKey | UKONEVKZPASWKD-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |