C17H17NOS3 — CID 8761867
4-(1,3-dithiolan-2-yl)-N-(3-methylsulfanylphenyl)benzamide (PubChem CID 8761867) has the molecular formula C17H17NOS3 and a molecular weight of 347.53 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-N-(3-methylsulfanylphenyl)benzamide.
| Compound Name | 4-(1,3-dithiolan-2-yl)-N-(3-methylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 8761867 |
| Molecular Formula | C17H17NOS3 |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-N-(3-methylsulfanylphenyl)benzamide |
| SMILES | CSc1cccc(NC(=O)c2ccc(C3SCCS3)cc2)c1 |
| InChI | InChI=1S/C17H17NOS3/c1-20-15-4-2-3-14(11-15)18-16(19)12-5-7-13(8-6-12)17-21-9-10-22-17/h2-8,11,17H,9-10H2,1H3,(H,18,19) |
| InChIKey | GWASQIRTTCZKIM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |