C19H13Cl2N7 — CID 169260201
8-N-(3-chlorophenyl)-4-N-[(4-chlorophenyl)methylideneamino]pyrimido[5,4-d]pyrimidine-4,8-diamine (PubChem CID 169260201) has the molecular formula C19H13Cl2N7 and a molecular weight of 410.27 g/mol. Its IUPAC name is 8-N-(3-chlorophenyl)-4-N-[(4-chlorophenyl)methylideneamino]pyrimido[5,4-d]pyrimidine-4,8-diamine.
| Compound Name | 8-N-(3-chlorophenyl)-4-N-[(4-chlorophenyl)methylideneamino]pyrimido[5,4-d]pyrimidine-4,8-diamine |
|---|---|
| PubChem CID | 169260201 |
| Molecular Formula | C19H13Cl2N7 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 8-N-(3-chlorophenyl)-4-N-[(4-chlorophenyl)methylideneamino]pyrimido[5,4-d]pyrimidine-4,8-diamine |
| SMILES | Clc1ccc(C=NNc2ncnc3c(Nc4cccc(Cl)c4)ncnc23)cc1 |
| InChI | InChI=1S/C19H13Cl2N7/c20-13-6-4-12(5-7-13)9-26-28-19-17-16(22-11-25-19)18(24-10-23-17)27-15-3-1-2-14(21)8-15/h1-11H,(H,22,25,28)(H,23,24,27) |
| InChIKey | CRBJCBBXLOEBRN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|