C18H14Cl2N6 — CID 86279724
4-N,6-N-bis[(E)-(4-chlorophenyl)methylideneamino]pyrimidine-4,6-diamine (PubChem CID 86279724) has the molecular formula C18H14Cl2N6 and a molecular weight of 385.26 g/mol. Its IUPAC name is 4-N,6-N-bis[(E)-(4-chlorophenyl)methylideneamino]pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-bis[(E)-(4-chlorophenyl)methylideneamino]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 86279724 |
| Molecular Formula | C18H14Cl2N6 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 4-N,6-N-bis[(E)-(4-chlorophenyl)methylideneamino]pyrimidine-4,6-diamine |
| SMILES | Clc1ccc(/C=N/Nc2cc(N/N=C/c3ccc(Cl)cc3)ncn2)cc1 |
| InChI | InChI=1S/C18H14Cl2N6/c19-15-5-1-13(2-6-15)10-23-25-17-9-18(22-12-21-17)26-24-11-14-3-7-16(20)8-4-14/h1-12H,(H2,21,22,25,26)/b23-10+,24-11+ |
| InChIKey | NMTQTHQTUCFUJB-HIWNQQMRSA-N |
| XLogP | 4.68 |
| TPSA | 74.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|