C19H13ClFN7O3 — CID 170312498
5-[(E)-[[8-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-4-yl]hydrazinylidene]methyl]benzene-1,2,3-triol (PubChem CID 170312498) has the molecular formula C19H13ClFN7O3 and a molecular weight of 441.81 g/mol. Its IUPAC name is 5-[(E)-[[8-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-4-yl]hydrazinylidene]methyl]benzene-1,2,3-triol.
| Compound Name | 5-[(E)-[[8-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-4-yl]hydrazinylidene]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 170312498 |
| Molecular Formula | C19H13ClFN7O3 |
| Molecular Weight | 441.81 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 5-[(E)-[[8-(3-chloro-4-fluoroanilino)pyrimido[5,4-d]pyrimidin-4-yl]hydrazinylidene]methyl]benzene-1,2,3-triol |
| SMILES | Oc1cc(/C=N/Nc2ncnc3c(Nc4ccc(F)c(Cl)c4)ncnc23)cc(O)c1O |
| InChI | InChI=1S/C19H13ClFN7O3/c20-11-5-10(1-2-12(11)21)27-18-15-16(23-7-24-18)19(25-8-22-15)28-26-6-9-3-13(29)17(31)14(30)4-9/h1-8,29-31H,(H,22,25,28)(H,23,24,27)/b26-6+ |
| InChIKey | SMBVRFISWAGJQE-GOTRBWPWSA-N |
| XLogP | 3.52 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.81 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|