C12H11ClFN5O — CID 73406992
4-N-(3-chloro-4-fluorophenyl)-5-(methoxyiminomethyl)pyrimidine-4,6-diamine (PubChem CID 73406992) has the molecular formula C12H11ClFN5O and a molecular weight of 295.71 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-5-(methoxyiminomethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-5-(methoxyiminomethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 73406992 |
| Molecular Formula | C12H11ClFN5O |
| Molecular Weight | 295.71 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-5-(methoxyiminomethyl)pyrimidine-4,6-diamine |
| SMILES | CON=Cc1c(N)ncnc1Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H11ClFN5O/c1-20-18-5-8-11(15)16-6-17-12(8)19-7-2-3-10(14)9(13)4-7/h2-6H,1H3,(H3,15,16,17,19) |
| InChIKey | LIQFDQDQUXXTBU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.71 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|