C18H18N6O2 — CID 73407016
5-(methoxyiminomethyl)-4-N-(3-methyl-4-pyridin-3-yloxyphenyl)pyrimidine-4,6-diamine (PubChem CID 73407016) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 5-(methoxyiminomethyl)-4-N-(3-methyl-4-pyridin-3-yloxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 5-(methoxyiminomethyl)-4-N-(3-methyl-4-pyridin-3-yloxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 73407016 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 5-(methoxyiminomethyl)-4-N-(3-methyl-4-pyridin-3-yloxyphenyl)pyrimidine-4,6-diamine |
| SMILES | CON=Cc1c(N)ncnc1Nc1ccc(Oc2cccnc2)c(C)c1 |
| InChI | InChI=1S/C18H18N6O2/c1-12-8-13(5-6-16(12)26-14-4-3-7-20-9-14)24-18-15(10-23-25-2)17(19)21-11-22-18/h3-11H,1-2H3,(H3,19,21,22,24) |
| InChIKey | CHDSNPNAIIGLHU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|