C19H15N3OS — CID 22112865
N-(4-phenylmethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine (PubChem CID 22112865) has the molecular formula C19H15N3OS and a molecular weight of 333.42 g/mol. Its IUPAC name is N-(4-phenylmethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-(4-phenylmethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22112865 |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(4-phenylmethoxyphenyl)thieno[3,2-d]pyrimidin-4-amine |
| SMILES | c1ccc(COc2ccc(Nc3ncnc4ccsc34)cc2)cc1 |
| InChI | InChI=1S/C19H15N3OS/c1-2-4-14(5-3-1)12-23-16-8-6-15(7-9-16)22-19-18-17(10-11-24-18)20-13-21-19/h1-11,13H,12H2,(H,20,21,22) |
| InChIKey | FZALGTPXQZDQND-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |