C19H16ClN3S — CID 22112828
N-(4-benzylphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride (PubChem CID 22112828) has the molecular formula C19H16ClN3S and a molecular weight of 353.88 g/mol. Its IUPAC name is N-(4-benzylphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride.
| Compound Name | N-(4-benzylphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 22112828 |
| Molecular Formula | C19H16ClN3S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-(4-benzylphenyl)thieno[3,2-d]pyrimidin-4-amine;hydrochloride |
| SMILES | Cl.c1ccc(Cc2ccc(Nc3ncnc4ccsc34)cc2)cc1 |
| InChI | InChI=1S/C19H15N3S.ClH/c1-2-4-14(5-3-1)12-15-6-8-16(9-7-15)22-19-18-17(10-11-23-18)20-13-21-19;/h1-11,13H,12H2,(H,20,21,22);1H |
| InChIKey | RVPPPWFQLYKPGM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |