C16H11BrN4S — CID 5328411
4-N-(3-bromophenyl)-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine (PubChem CID 5328411) has the molecular formula C16H11BrN4S and a molecular weight of 371.26 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine.
| Compound Name | 4-N-(3-bromophenyl)-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine |
|---|---|
| PubChem CID | 5328411 |
| Molecular Formula | C16H11BrN4S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 4-N-(3-bromophenyl)-[1]benzothiolo[3,2-d]pyrimidine-4,7-diamine |
| SMILES | Nc1ccc2c(c1)sc1c(Nc3cccc(Br)c3)ncnc12 |
| InChI | InChI=1S/C16H11BrN4S/c17-9-2-1-3-11(6-9)21-16-15-14(19-8-20-16)12-5-4-10(18)7-13(12)22-15/h1-8H,18H2,(H,19,20,21) |
| InChIKey | VTCCFNSRHBUEKC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|