C18H15N3S — CID 5328400
N-[(1R)-1-phenylethyl]-[1]benzothiolo[3,2-d]pyrimidin-4-amine (PubChem CID 5328400) has the molecular formula C18H15N3S and a molecular weight of 305.41 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-[1]benzothiolo[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-phenylethyl]-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5328400 |
| Molecular Formula | C18H15N3S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-[1]benzothiolo[3,2-d]pyrimidin-4-amine |
| SMILES | C[C@@H](Nc1ncnc2c1sc1ccccc12)c1ccccc1 |
| InChI | InChI=1S/C18H15N3S/c1-12(13-7-3-2-4-8-13)21-18-17-16(19-11-20-18)14-9-5-6-10-15(14)22-17/h2-12H,1H3,(H,19,20,21)/t12-/m1/s1 |
| InChIKey | WXXYNGFRGPWDFC-GFCCVEGCSA-N |
| XLogP | 5.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |