C25H18FN3O2 — CID 141012706
N-[4-[(3-fluorophenyl)methoxy]phenyl]-6-(furan-2-yl)quinazolin-4-amine (PubChem CID 141012706) has the molecular formula C25H18FN3O2 and a molecular weight of 411.44 g/mol. Its IUPAC name is N-[4-[(3-fluorophenyl)methoxy]phenyl]-6-(furan-2-yl)quinazolin-4-amine.
| Compound Name | N-[4-[(3-fluorophenyl)methoxy]phenyl]-6-(furan-2-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 141012706 |
| Molecular Formula | C25H18FN3O2 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[4-[(3-fluorophenyl)methoxy]phenyl]-6-(furan-2-yl)quinazolin-4-amine |
| SMILES | Fc1cccc(COc2ccc(Nc3ncnc4ccc(-c5ccco5)cc34)cc2)c1 |
| InChI | InChI=1S/C25H18FN3O2/c26-19-4-1-3-17(13-19)15-31-21-9-7-20(8-10-21)29-25-22-14-18(24-5-2-12-30-24)6-11-23(22)27-16-28-25/h1-14,16H,15H2,(H,27,28,29) |
| InChIKey | KAKZBWJERSXJJH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |